C16H14Br2N2O — CID 107599706
N-(2,6-dibromophenyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 107599706) has the molecular formula C16H14Br2N2O and a molecular weight of 410.11 g/mol. Its IUPAC name is N-(2,6-dibromophenyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | N-(2,6-dibromophenyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 107599706 |
| Molecular Formula | C16H14Br2N2O |
| Molecular Weight | 410.11 g/mol |
| Exact Mass | 407.95 |
| IUPAC Name | N-(2,6-dibromophenyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | O=C(Nc1c(Br)cccc1Br)C1Cc2ccccc2CN1 |
| InChI | InChI=1S/C16H14Br2N2O/c17-12-6-3-7-13(18)15(12)20-16(21)14-8-10-4-1-2-5-11(10)9-19-14/h1-7,14,19H,8-9H2,(H,20,21) |
| InChIKey | ZTPYWRLAITUQMN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.11 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |