C11H14N2O3S — CID 103287323
(3S)-N-methylsulfonyl-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 103287323) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is (3S)-N-methylsulfonyl-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | (3S)-N-methylsulfonyl-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 103287323 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (3S)-N-methylsulfonyl-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)[C@@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C11H14N2O3S/c1-17(15,16)13-11(14)10-6-8-4-2-3-5-9(8)7-12-10/h2-5,10,12H,6-7H2,1H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | INPAFXHEVUICCO-JTQLQIEISA-N |
| XLogP | -0.22 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |