C12H17N3O — CID 83021398
(3R)-N',N'-dimethyl-1,2,3,4-tetrahydroisoquinoline-3-carbohydrazide (PubChem CID 83021398) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is (3R)-N',N'-dimethyl-1,2,3,4-tetrahydroisoquinoline-3-carbohydrazide.
| Compound Name | (3R)-N',N'-dimethyl-1,2,3,4-tetrahydroisoquinoline-3-carbohydrazide |
|---|---|
| PubChem CID | 83021398 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | (3R)-N',N'-dimethyl-1,2,3,4-tetrahydroisoquinoline-3-carbohydrazide |
| SMILES | CN(C)NC(=O)[C@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C12H17N3O/c1-15(2)14-12(16)11-7-9-5-3-4-6-10(9)8-13-11/h3-6,11,13H,7-8H2,1-2H3,(H,14,16)/t11-/m1/s1 |
| InChIKey | CZBWLLPDNUHXDA-LLVKDONJSA-N |
| XLogP | 0.29 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|