C13H19N3O3S — CID 104896151
(3S)-N-[2-(methanesulfonamido)ethyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 104896151) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is (3S)-N-[2-(methanesulfonamido)ethyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | (3S)-N-[2-(methanesulfonamido)ethyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 104896151 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (3S)-N-[2-(methanesulfonamido)ethyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | CS(=O)(=O)NCCNC(=O)[C@@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C13H19N3O3S/c1-20(18,19)16-7-6-14-13(17)12-8-10-4-2-3-5-11(10)9-15-12/h2-5,12,15-16H,6-9H2,1H3,(H,14,17)/t12-/m0/s1 |
| InChIKey | IFKSTBYARYQZQH-LBPRGKRZSA-N |
| XLogP | -0.63 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|