C17H27N3O — CID 106047759
N-[3-[methyl(propan-2-yl)amino]propyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 106047759) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is N-[3-[methyl(propan-2-yl)amino]propyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | N-[3-[methyl(propan-2-yl)amino]propyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 106047759 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | N-[3-[methyl(propan-2-yl)amino]propyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | CC(C)N(C)CCCNC(=O)C1Cc2ccccc2CN1 |
| InChI | InChI=1S/C17H27N3O/c1-13(2)20(3)10-6-9-18-17(21)16-11-14-7-4-5-8-15(14)12-19-16/h4-5,7-8,13,16,19H,6,9-12H2,1-3H3,(H,18,21) |
| InChIKey | RPXMAHHHUNTUQT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|