C16H22N2O3 — CID 104896592
ethyl 4-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]butanoate (PubChem CID 104896592) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is ethyl 4-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]butanoate.
| Compound Name | ethyl 4-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 104896592 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | ethyl 4-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)[C@@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C16H22N2O3/c1-2-21-15(19)8-5-9-17-16(20)14-10-12-6-3-4-7-13(12)11-18-14/h3-4,6-7,14,18H,2,5,8-11H2,1H3,(H,17,20)/t14-/m0/s1 |
| InChIKey | WEUQUVMCWLHRGC-AWEZNQCLSA-N |
| XLogP | 1.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|