C14H20N2O2 — CID 4903679
N-(3-methoxypropyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 4903679) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is N-(3-methoxypropyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | N-(3-methoxypropyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 4903679 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | N-(3-methoxypropyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | COCCCNC(=O)C1Cc2ccccc2CN1 |
| InChI | InChI=1S/C14H20N2O2/c1-18-8-4-7-15-14(17)13-9-11-5-2-3-6-12(11)10-16-13/h2-3,5-6,13,16H,4,7-10H2,1H3,(H,15,17) |
| InChIKey | ZVWDLRFAAHZNAF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|