About N-(3-methoxypropyl)-2,3-dihydro-1H-indole-2-carboxamide
N-(3-methoxypropyl)-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 76892809) has the molecular formula C13H18N2O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2,3-dihydro-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | N-(3-methoxypropyl)-2,3-dihydro-1H-indole-2-carboxamide |
| PubChem CID | 76892809 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | N-(3-methoxypropyl)-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | COCCCNC(=O)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C13H18N2O2/c1-17-8-4-7-14-13(16)12-9-10-5-2-3-6-11(10)15-12/h2-3,5-6,12,15H,4,7-9H2,1H3,(H,14,16) |
| InChIKey | POYAXRGUSKHXIC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methoxypropyl)-2,3-dihydro-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxypropyl)-2,3-dihydro-1H-indole-2-carboxamide?
The IUPAC name of N-(3-methoxypropyl)-2,3-dihydro-1H-indole-2-carboxamide (CID 76892809) is N-(3-methoxypropyl)-2,3-dihydro-1H-indole-2-carboxamide.
What is the SMILES notation for N-(3-methoxypropyl)-2,3-dihydro-1H-indole-2-carboxamide?
The canonical SMILES for N-(3-methoxypropyl)-2,3-dihydro-1H-indole-2-carboxamide is COCCCNC(=O)C1Cc2ccccc2N1.
What is the InChIKey of N-(3-methoxypropyl)-2,3-dihydro-1H-indole-2-carboxamide?
The InChIKey is POYAXRGUSKHXIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2/c1-17-8-4-7-14-13(16)12-9-10-5-2-3-6-11(10)15-12/h2-3,5-6,12,15H,4,7-9H2,1H3,(H,14,16).
What are the key properties of N-(3-methoxypropyl)-2,3-dihydro-1H-indole-2-carboxamide?
N-(3-methoxypropyl)-2,3-dihydro-1H-indole-2-carboxamide has a molecular weight of 234.30 g/mol, XLogP of 1.18, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxypropyl)-2,3-dihydro-1H-indole-2-carboxamide is sourced from PubChem (CID 76892809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).