C13H18N2O2 — CID 106842127
N-(4-hydroxybutyl)-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 106842127) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-(4-hydroxybutyl)-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 106842127 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | N-(4-hydroxybutyl)-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | O=C(NCCCCO)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C13H18N2O2/c16-8-4-3-7-14-13(17)12-9-10-5-1-2-6-11(10)15-12/h1-2,5-6,12,15-16H,3-4,7-9H2,(H,14,17) |
| InChIKey | JZTQHBAQVIGECR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|