C15H20N2O3 — CID 103869585
5-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]pentanoic acid (PubChem CID 103869585) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 5-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]pentanoic acid.
| Compound Name | 5-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 103869585 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 5-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)[C@@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C15H20N2O3/c18-14(19)7-3-4-8-16-15(20)13-9-11-5-1-2-6-12(11)10-17-13/h1-2,5-6,13,17H,3-4,7-10H2,(H,16,20)(H,18,19)/t13-/m0/s1 |
| InChIKey | RQOJDJMBYYVIED-ZDUSSCGKSA-N |
| XLogP | 1.07 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|