C14H17N3O — CID 104900946
(2R)-N-[(3-cyanophenyl)methyl]-N-methylpyrrolidine-2-carboxamide (PubChem CID 104900946) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is (2R)-N-[(3-cyanophenyl)methyl]-N-methylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[(3-cyanophenyl)methyl]-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 104900946 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | (2R)-N-[(3-cyanophenyl)methyl]-N-methylpyrrolidine-2-carboxamide |
| SMILES | CN(Cc1cccc(C#N)c1)C(=O)[C@H]1CCCN1 |
| InChI | InChI=1S/C14H17N3O/c1-17(14(18)13-6-3-7-16-13)10-12-5-2-4-11(8-12)9-15/h2,4-5,8,13,16H,3,6-7,10H2,1H3/t13-/m1/s1 |
| InChIKey | GMSRSXCXJUWYGL-CYBMUJFWSA-N |
| XLogP | 1.27 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |