C15H18N2O3S — CID 104519281
N-[(3-cyanophenyl)methyl]-N-methyl-1,1-dioxothiane-2-carboxamide (PubChem CID 104519281) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is N-[(3-cyanophenyl)methyl]-N-methyl-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-[(3-cyanophenyl)methyl]-N-methyl-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 104519281 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-[(3-cyanophenyl)methyl]-N-methyl-1,1-dioxothiane-2-carboxamide |
| SMILES | CN(Cc1cccc(C#N)c1)C(=O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C15H18N2O3S/c1-17(11-13-6-4-5-12(9-13)10-16)15(18)14-7-2-3-8-21(14,19)20/h4-6,9,14H,2-3,7-8,11H2,1H3 |
| InChIKey | SKEWNAPSBIKQQM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |