C16H20N2O3 — CID 86868338
N-[(3-cyanophenyl)methyl]-N-methyl-2-(oxolan-2-ylmethoxy)acetamide (PubChem CID 86868338) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-[(3-cyanophenyl)methyl]-N-methyl-2-(oxolan-2-ylmethoxy)acetamide.
| Compound Name | N-[(3-cyanophenyl)methyl]-N-methyl-2-(oxolan-2-ylmethoxy)acetamide |
|---|---|
| PubChem CID | 86868338 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-[(3-cyanophenyl)methyl]-N-methyl-2-(oxolan-2-ylmethoxy)acetamide |
| SMILES | CN(Cc1cccc(C#N)c1)C(=O)COCC1CCCO1 |
| InChI | InChI=1S/C16H20N2O3/c1-18(10-14-5-2-4-13(8-14)9-17)16(19)12-20-11-15-6-3-7-21-15/h2,4-5,8,15H,3,6-7,10-12H2,1H3 |
| InChIKey | QETHJTRUNAKFGH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |