C15H12O3 — CID 10490203
7,8-dimethoxyphenalen-1-one (PubChem CID 10490203) has the molecular formula C15H12O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 7,8-dimethoxyphenalen-1-one.
| Compound Name | 7,8-dimethoxyphenalen-1-one |
|---|---|
| PubChem CID | 10490203 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 7,8-dimethoxyphenalen-1-one |
| SMILES | COc1cc2c3c(cccc3c1OC)C=CC2=O |
| InChI | InChI=1S/C15H12O3/c1-17-13-8-11-12(16)7-6-9-4-3-5-10(14(9)11)15(13)18-2/h3-8H,1-2H3 |
| InChIKey | VSAJIRCNFDONFN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |