C14H19N3O2 — CID 104902849
(2R)-2-amino-N-[3-(cyanomethoxy)phenyl]-4-methylpentanamide (PubChem CID 104902849) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is (2R)-2-amino-N-[3-(cyanomethoxy)phenyl]-4-methylpentanamide.
| Compound Name | (2R)-2-amino-N-[3-(cyanomethoxy)phenyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 104902849 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (2R)-2-amino-N-[3-(cyanomethoxy)phenyl]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](N)C(=O)Nc1cccc(OCC#N)c1 |
| InChI | InChI=1S/C14H19N3O2/c1-10(2)8-13(16)14(18)17-11-4-3-5-12(9-11)19-7-6-15/h3-5,9-10,13H,7-8,16H2,1-2H3,(H,17,18)/t13-/m1/s1 |
| InChIKey | SHJVLVJKGUXPMS-CYBMUJFWSA-N |
| XLogP | 1.90 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |