C12H13N3O4 — CID 64897249
3-amino-4-[3-(cyanomethoxy)anilino]-4-oxobutanoic acid (PubChem CID 64897249) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 3-amino-4-[3-(cyanomethoxy)anilino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[3-(cyanomethoxy)anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 64897249 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 3-amino-4-[3-(cyanomethoxy)anilino]-4-oxobutanoic acid |
| SMILES | N#CCOc1cccc(NC(=O)C(N)CC(=O)O)c1 |
| InChI | InChI=1S/C12H13N3O4/c13-4-5-19-9-3-1-2-8(6-9)15-12(18)10(14)7-11(16)17/h1-3,6,10H,5,7,14H2,(H,15,18)(H,16,17) |
| InChIKey | HJLYMLVJOHSSOP-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 125.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |