C12H20O5 — CID 10490481
dimethyl (Z)-2-(2-ethyl-1-hydroxybutyl)but-2-enedioate (PubChem CID 10490481) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is dimethyl (Z)-2-(2-ethyl-1-hydroxybutyl)but-2-enedioate.
| Compound Name | dimethyl (Z)-2-(2-ethyl-1-hydroxybutyl)but-2-enedioate |
|---|---|
| PubChem CID | 10490481 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | dimethyl (Z)-2-(2-ethyl-1-hydroxybutyl)but-2-enedioate |
| SMILES | CCC(CC)C(O)/C(=C/C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C12H20O5/c1-5-8(6-2)11(14)9(12(15)17-4)7-10(13)16-3/h7-8,11,14H,5-6H2,1-4H3/b9-7- |
| InChIKey | AKKHGLLXCYJQOS-CLFYSBASSA-N |
| XLogP | 1.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|