C14H20N2O4 — CID 104904977
methyl 4-[[(2R)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]butanoate (PubChem CID 104904977) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl 4-[[(2R)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]butanoate.
| Compound Name | methyl 4-[[(2R)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]butanoate |
|---|---|
| PubChem CID | 104904977 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | methyl 4-[[(2R)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)[C@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C14H20N2O4/c1-20-13(18)3-2-8-16-14(19)12(15)9-10-4-6-11(17)7-5-10/h4-7,12,17H,2-3,8-9,15H2,1H3,(H,16,19)/t12-/m1/s1 |
| InChIKey | RXBZTVMXWKDLPE-GFCCVEGCSA-N |
| XLogP | 0.33 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|