C16H27N3O2 — CID 104905021
(2R)-2-amino-N-[1-(dimethylamino)-3-methylbutan-2-yl]-3-(4-hydroxyphenyl)propanamide (PubChem CID 104905021) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is (2R)-2-amino-N-[1-(dimethylamino)-3-methylbutan-2-yl]-3-(4-hydroxyphenyl)propanamide.
| Compound Name | (2R)-2-amino-N-[1-(dimethylamino)-3-methylbutan-2-yl]-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 104905021 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | (2R)-2-amino-N-[1-(dimethylamino)-3-methylbutan-2-yl]-3-(4-hydroxyphenyl)propanamide |
| SMILES | CC(C)C(CN(C)C)NC(=O)[C@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C16H27N3O2/c1-11(2)15(10-19(3)4)18-16(21)14(17)9-12-5-7-13(20)8-6-12/h5-8,11,14-15,20H,9-10,17H2,1-4H3,(H,18,21)/t14-,15?/m1/s1 |
| InChIKey | RIGDMDNYIJOAGK-GICMACPYSA-N |
| XLogP | 0.96 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |