C10H19N3OS2 — CID 104909461
(1R)-3-methylsulfanyl-1-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]propan-1-amine (PubChem CID 104909461) has the molecular formula C10H19N3OS2 and a molecular weight of 261.42 g/mol. Its IUPAC name is (1R)-3-methylsulfanyl-1-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]propan-1-amine.
| Compound Name | (1R)-3-methylsulfanyl-1-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]propan-1-amine |
|---|---|
| PubChem CID | 104909461 |
| Molecular Formula | C10H19N3OS2 |
| Molecular Weight | 261.42 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (1R)-3-methylsulfanyl-1-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]propan-1-amine |
| SMILES | CCCSCc1noc([C@H](N)CCSC)n1 |
| InChI | InChI=1S/C10H19N3OS2/c1-3-5-16-7-9-12-10(14-13-9)8(11)4-6-15-2/h8H,3-7,11H2,1-2H3/t8-/m1/s1 |
| InChIKey | MNTJJPJQMIBCFZ-MRVPVSSYSA-N |
| XLogP | 2.47 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|