C14H19N3O2S — CID 65129613
4-[2-amino-2-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]ethyl]phenol (PubChem CID 65129613) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 4-[2-amino-2-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]ethyl]phenol.
| Compound Name | 4-[2-amino-2-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]ethyl]phenol |
|---|---|
| PubChem CID | 65129613 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 4-[2-amino-2-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]ethyl]phenol |
| SMILES | CCCSCc1noc(C(N)Cc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C14H19N3O2S/c1-2-7-20-9-13-16-14(19-17-13)12(15)8-10-3-5-11(18)6-4-10/h3-6,12,18H,2,7-9,15H2,1H3 |
| InChIKey | AQCNXWMVBFOIHI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|