C14H26N2O3S — CID 104909955
(2R)-2-(2-cyclohexylethylcarbamoylamino)-4-methylsulfanylbutanoic acid (PubChem CID 104909955) has the molecular formula C14H26N2O3S and a molecular weight of 302.44 g/mol. Its IUPAC name is (2R)-2-(2-cyclohexylethylcarbamoylamino)-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-(2-cyclohexylethylcarbamoylamino)-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 104909955 |
| Molecular Formula | C14H26N2O3S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (2R)-2-(2-cyclohexylethylcarbamoylamino)-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)NCCC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C14H26N2O3S/c1-20-10-8-12(13(17)18)16-14(19)15-9-7-11-5-3-2-4-6-11/h11-12H,2-10H2,1H3,(H,17,18)(H2,15,16,19)/t12-/m1/s1 |
| InChIKey | VSKKOZPOEPKHAA-GFCCVEGCSA-N |
| XLogP | 2.46 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |