C14H27N3O3S — CID 63316569
2-[2-[cyclopentyl(methyl)amino]ethylcarbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 63316569) has the molecular formula C14H27N3O3S and a molecular weight of 317.46 g/mol. Its IUPAC name is 2-[2-[cyclopentyl(methyl)amino]ethylcarbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[2-[cyclopentyl(methyl)amino]ethylcarbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 63316569 |
| Molecular Formula | C14H27N3O3S |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 2-[2-[cyclopentyl(methyl)amino]ethylcarbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)NCCN(C)C1CCCC1)C(=O)O |
| InChI | InChI=1S/C14H27N3O3S/c1-17(11-5-3-4-6-11)9-8-15-14(20)16-12(13(18)19)7-10-21-2/h11-12H,3-10H2,1-2H3,(H,18,19)(H2,15,16,20) |
| InChIKey | JIBVOPAGGCPXIU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |