C16H19N3O — CID 104911059
(2R)-2-amino-3-(1H-indol-3-yl)-N-pent-3-ynylpropanamide (PubChem CID 104911059) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is (2R)-2-amino-3-(1H-indol-3-yl)-N-pent-3-ynylpropanamide.
| Compound Name | (2R)-2-amino-3-(1H-indol-3-yl)-N-pent-3-ynylpropanamide |
|---|---|
| PubChem CID | 104911059 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | (2R)-2-amino-3-(1H-indol-3-yl)-N-pent-3-ynylpropanamide |
| SMILES | CC#CCCNC(=O)[C@H](N)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H19N3O/c1-2-3-6-9-18-16(20)14(17)10-12-11-19-15-8-5-4-7-13(12)15/h4-5,7-8,11,14,19H,6,9-10,17H2,1H3,(H,18,20)/t14-/m1/s1 |
| InChIKey | BDIIXXGXJZRSNW-CQSZACIVSA-N |
| XLogP | 1.57 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|