C12H13N3O2 — CID 104911082
(5S)-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-3-ol (PubChem CID 104911082) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is (5S)-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-3-ol.
| Compound Name | (5S)-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 104911082 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | (5S)-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-3-ol |
| SMILES | OC1CN[C@H](c2nc(-c3ccccc3)no2)C1 |
| InChI | InChI=1S/C12H13N3O2/c16-9-6-10(13-7-9)12-14-11(15-17-12)8-4-2-1-3-5-8/h1-5,9-10,13,16H,6-7H2/t9?,10-/m0/s1 |
| InChIKey | VXDKTVTUFGBYQL-AXDSSHIGSA-N |
| XLogP | 1.13 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |