C12H11Cl2N3O2 — CID 107917770
(3R,5R)-5-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol (PubChem CID 107917770) has the molecular formula C12H11Cl2N3O2 and a molecular weight of 300.15 g/mol. Its IUPAC name is (3R,5R)-5-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol.
| Compound Name | (3R,5R)-5-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 107917770 |
| Molecular Formula | C12H11Cl2N3O2 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | (3R,5R)-5-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol |
| SMILES | O[C@H]1CN[C@@H](c2nc(-c3cc(Cl)cc(Cl)c3)no2)C1 |
| InChI | InChI=1S/C12H11Cl2N3O2/c13-7-1-6(2-8(14)3-7)11-16-12(19-17-11)10-4-9(18)5-15-10/h1-3,9-10,15,18H,4-5H2/t9-,10-/m1/s1 |
| InChIKey | JNPIGMMWPWGBIL-NXEZZACHSA-N |
| XLogP | 2.44 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |