C16H23N3O2 — CID 104911223
(5S)-5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol (PubChem CID 104911223) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is (5S)-5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol.
| Compound Name | (5S)-5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 104911223 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (5S)-5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol |
| SMILES | OC1CN[C@H](c2nc(C34CC5CC(CC(C5)C3)C4)no2)C1 |
| InChI | InChI=1S/C16H23N3O2/c20-12-4-13(17-8-12)14-18-15(19-21-14)16-5-9-1-10(6-16)3-11(2-9)7-16/h9-13,17,20H,1-8H2/t9?,10?,11?,12?,13-,16?/m0/s1 |
| InChIKey | GTGFZUATAJHZDR-VSZIENKLSA-N |
| XLogP | 1.93 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |