C16H19N3O2 — CID 114350993
5-[3-(1-phenylcyclobutyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol (PubChem CID 114350993) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 5-[3-(1-phenylcyclobutyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol.
| Compound Name | 5-[3-(1-phenylcyclobutyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 114350993 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 5-[3-(1-phenylcyclobutyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol |
| SMILES | OC1CNC(c2nc(C3(c4ccccc4)CCC3)no2)C1 |
| InChI | InChI=1S/C16H19N3O2/c20-12-9-13(17-10-12)14-18-15(19-21-14)16(7-4-8-16)11-5-2-1-3-6-11/h1-3,5-6,12-13,17,20H,4,7-10H2 |
| InChIKey | YNFWYDTXTQGHOL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |