C11H19N3O2 — CID 104911843
3-(1-ethoxyethyl)-5-[(3R)-piperidin-3-yl]-1,2,4-oxadiazole (PubChem CID 104911843) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-(1-ethoxyethyl)-5-[(3R)-piperidin-3-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(1-ethoxyethyl)-5-[(3R)-piperidin-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 104911843 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 3-(1-ethoxyethyl)-5-[(3R)-piperidin-3-yl]-1,2,4-oxadiazole |
| SMILES | CCOC(C)c1noc([C@@H]2CCCNC2)n1 |
| InChI | InChI=1S/C11H19N3O2/c1-3-15-8(2)10-13-11(16-14-10)9-5-4-6-12-7-9/h8-9,12H,3-7H2,1-2H3/t8?,9-/m1/s1 |
| InChIKey | UGOCORJQLGWZPJ-YGPZHTELSA-N |
| XLogP | 1.63 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |