C16H18O3 — CID 10491430
2-(1-hydroxy-1-phenylpropyl)-5-methylbenzene-1,4-diol (PubChem CID 10491430) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-(1-hydroxy-1-phenylpropyl)-5-methylbenzene-1,4-diol.
| Compound Name | 2-(1-hydroxy-1-phenylpropyl)-5-methylbenzene-1,4-diol |
|---|---|
| PubChem CID | 10491430 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 2-(1-hydroxy-1-phenylpropyl)-5-methylbenzene-1,4-diol |
| SMILES | CCC(O)(c1ccccc1)c1cc(O)c(C)cc1O |
| InChI | InChI=1S/C16H18O3/c1-3-16(19,12-7-5-4-6-8-12)13-10-14(17)11(2)9-15(13)18/h4-10,17-19H,3H2,1-2H3 |
| InChIKey | OQBXNCLQNBGHMI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|