C15H16O3 — CID 10562254
2-(1-hydroxy-1-phenylethyl)-5-methylbenzene-1,4-diol (PubChem CID 10562254) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-(1-hydroxy-1-phenylethyl)-5-methylbenzene-1,4-diol.
| Compound Name | 2-(1-hydroxy-1-phenylethyl)-5-methylbenzene-1,4-diol |
|---|---|
| PubChem CID | 10562254 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 2-(1-hydroxy-1-phenylethyl)-5-methylbenzene-1,4-diol |
| SMILES | Cc1cc(O)c(C(C)(O)c2ccccc2)cc1O |
| InChI | InChI=1S/C15H16O3/c1-10-8-14(17)12(9-13(10)16)15(2,18)11-6-4-3-5-7-11/h3-9,16-18H,1-2H3 |
| InChIKey | FOFOZPAKWVUPKV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|