C21H20O3 — CID 139838653
4-[1-(4-hydroxy-3-methylphenyl)-1-phenylethyl]benzene-1,3-diol (PubChem CID 139838653) has the molecular formula C21H20O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 4-[1-(4-hydroxy-3-methylphenyl)-1-phenylethyl]benzene-1,3-diol.
| Compound Name | 4-[1-(4-hydroxy-3-methylphenyl)-1-phenylethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 139838653 |
| Molecular Formula | C21H20O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 4-[1-(4-hydroxy-3-methylphenyl)-1-phenylethyl]benzene-1,3-diol |
| SMILES | Cc1cc(C(C)(c2ccccc2)c2ccc(O)cc2O)ccc1O |
| InChI | InChI=1S/C21H20O3/c1-14-12-16(8-11-19(14)23)21(2,15-6-4-3-5-7-15)18-10-9-17(22)13-20(18)24/h3-13,22-24H,1-2H3 |
| InChIKey | OJXKFRHNLLQWGC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|