C23H21F3O3 — CID 126486197
4-[1-(4-hydroxyphenyl)-1-phenylethyl]-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenol (PubChem CID 126486197) has the molecular formula C23H21F3O3 and a molecular weight of 402.41 g/mol. Its IUPAC name is 4-[1-(4-hydroxyphenyl)-1-phenylethyl]-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenol.
| Compound Name | 4-[1-(4-hydroxyphenyl)-1-phenylethyl]-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenol |
|---|---|
| PubChem CID | 126486197 |
| Molecular Formula | C23H21F3O3 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 4-[1-(4-hydroxyphenyl)-1-phenylethyl]-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenol |
| SMILES | CC(c1ccccc1)(c1ccc(O)cc1)c1ccc(O)c(C(C)(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C23H21F3O3/c1-21(15-6-4-3-5-7-15,16-8-11-18(27)12-9-16)17-10-13-20(28)19(14-17)22(2,29)23(24,25)26/h3-14,27-29H,1-2H3 |
| InChIKey | RVAJLEBSVALYKZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|