C14H18N2O4 — CID 104914466
4-methoxy-2-[[(2S)-piperidine-2-carbonyl]amino]benzoic acid (PubChem CID 104914466) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-methoxy-2-[[(2S)-piperidine-2-carbonyl]amino]benzoic acid.
| Compound Name | 4-methoxy-2-[[(2S)-piperidine-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 104914466 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-methoxy-2-[[(2S)-piperidine-2-carbonyl]amino]benzoic acid |
| SMILES | COc1ccc(C(=O)O)c(NC(=O)[C@@H]2CCCCN2)c1 |
| InChI | InChI=1S/C14H18N2O4/c1-20-9-5-6-10(14(18)19)12(8-9)16-13(17)11-4-2-3-7-15-11/h5-6,8,11,15H,2-4,7H2,1H3,(H,16,17)(H,18,19)/t11-/m0/s1 |
| InChIKey | APGDCHNUWDOJPR-NSHDSACASA-N |
| XLogP | 1.47 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |