C13H14F2N2O3 — CID 104913876
4,5-difluoro-2-[[(2S)-piperidine-2-carbonyl]amino]benzoic acid (PubChem CID 104913876) has the molecular formula C13H14F2N2O3 and a molecular weight of 284.26 g/mol. Its IUPAC name is 4,5-difluoro-2-[[(2S)-piperidine-2-carbonyl]amino]benzoic acid.
| Compound Name | 4,5-difluoro-2-[[(2S)-piperidine-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 104913876 |
| Molecular Formula | C13H14F2N2O3 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 4,5-difluoro-2-[[(2S)-piperidine-2-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1cc(F)c(F)cc1NC(=O)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C13H14F2N2O3/c14-8-5-7(13(19)20)11(6-9(8)15)17-12(18)10-3-1-2-4-16-10/h5-6,10,16H,1-4H2,(H,17,18)(H,19,20)/t10-/m0/s1 |
| InChIKey | KDGWMYPTMMNEAX-JTQLQIEISA-N |
| XLogP | 1.74 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |