C9H16N2O2 — CID 104914649
1,2-oxazolidin-2-yl-[(2S)-piperidin-2-yl]methanone (PubChem CID 104914649) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 1,2-oxazolidin-2-yl-[(2S)-piperidin-2-yl]methanone.
| Compound Name | 1,2-oxazolidin-2-yl-[(2S)-piperidin-2-yl]methanone |
|---|---|
| PubChem CID | 104914649 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 1,2-oxazolidin-2-yl-[(2S)-piperidin-2-yl]methanone |
| SMILES | O=C([C@@H]1CCCCN1)N1CCCO1 |
| InChI | InChI=1S/C9H16N2O2/c12-9(11-6-3-7-13-11)8-4-1-2-5-10-8/h8,10H,1-7H2/t8-/m0/s1 |
| InChIKey | GLHXEYWINMQSEQ-QMMMGPOBSA-N |
| XLogP | 0.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |