C15H25N3O2 — CID 104915174
3-(1-ethoxycyclohexyl)-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole (PubChem CID 104915174) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 3-(1-ethoxycyclohexyl)-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(1-ethoxycyclohexyl)-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 104915174 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 3-(1-ethoxycyclohexyl)-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole |
| SMILES | CCOC1(c2noc([C@H]3CCCCN3)n2)CCCCC1 |
| InChI | InChI=1S/C15H25N3O2/c1-2-19-15(9-5-3-6-10-15)14-17-13(20-18-14)12-8-4-7-11-16-12/h12,16H,2-11H2,1H3/t12-/m1/s1 |
| InChIKey | QPZKGZQDRKGZCZ-GFCCVEGCSA-N |
| XLogP | 3.08 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |