C14H23N3O2 — CID 116741549
3-(1-ethoxycyclopentyl)-5-piperidin-2-yl-1,2,4-oxadiazole (PubChem CID 116741549) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-(1-ethoxycyclopentyl)-5-piperidin-2-yl-1,2,4-oxadiazole.
| Compound Name | 3-(1-ethoxycyclopentyl)-5-piperidin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 116741549 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 3-(1-ethoxycyclopentyl)-5-piperidin-2-yl-1,2,4-oxadiazole |
| SMILES | CCOC1(c2noc(C3CCCCN3)n2)CCCC1 |
| InChI | InChI=1S/C14H23N3O2/c1-2-18-14(8-4-5-9-14)13-16-12(19-17-13)11-7-3-6-10-15-11/h11,15H,2-10H2,1H3 |
| InChIKey | LHWJKOGAPULPGL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |