C17H23N3O — CID 104915277
(1R)-1-[3-(1-phenylcyclohexyl)-1,2,4-oxadiazol-5-yl]propan-1-amine (PubChem CID 104915277) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is (1R)-1-[3-(1-phenylcyclohexyl)-1,2,4-oxadiazol-5-yl]propan-1-amine.
| Compound Name | (1R)-1-[3-(1-phenylcyclohexyl)-1,2,4-oxadiazol-5-yl]propan-1-amine |
|---|---|
| PubChem CID | 104915277 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | (1R)-1-[3-(1-phenylcyclohexyl)-1,2,4-oxadiazol-5-yl]propan-1-amine |
| SMILES | CC[C@@H](N)c1nc(C2(c3ccccc3)CCCCC2)no1 |
| InChI | InChI=1S/C17H23N3O/c1-2-14(18)15-19-16(20-21-15)17(11-7-4-8-12-17)13-9-5-3-6-10-13/h3,5-6,9-10,14H,2,4,7-8,11-12,18H2,1H3/t14-/m1/s1 |
| InChIKey | VIFBBYKXLWFGNH-CQSZACIVSA-N |
| XLogP | 3.73 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |