C10H8F3N3O2 — CID 104915667
(2R)-2-amino-2-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol (PubChem CID 104915667) has the molecular formula C10H8F3N3O2 and a molecular weight of 259.19 g/mol. Its IUPAC name is (2R)-2-amino-2-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol.
| Compound Name | (2R)-2-amino-2-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 104915667 |
| Molecular Formula | C10H8F3N3O2 |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | (2R)-2-amino-2-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol |
| SMILES | N[C@H](CO)c1nc(-c2cc(F)c(F)c(F)c2)no1 |
| InChI | InChI=1S/C10H8F3N3O2/c11-5-1-4(2-6(12)8(5)13)9-15-10(18-16-9)7(14)3-17/h1-2,7,17H,3,14H2/t7-/m1/s1 |
| InChIKey | XAVKORAFQHIGFV-SSDOTTSWSA-N |
| XLogP | 1.15 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|