C10H8F2N4O4 — CID 114985996
(2R)-2-amino-2-[3-(2,6-difluoro-3-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethanol (PubChem CID 114985996) has the molecular formula C10H8F2N4O4 and a molecular weight of 286.19 g/mol. Its IUPAC name is (2R)-2-amino-2-[3-(2,6-difluoro-3-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethanol.
| Compound Name | (2R)-2-amino-2-[3-(2,6-difluoro-3-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 114985996 |
| Molecular Formula | C10H8F2N4O4 |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | (2R)-2-amino-2-[3-(2,6-difluoro-3-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethanol |
| SMILES | N[C@H](CO)c1nc(-c2c(F)ccc([N+](=O)[O-])c2F)no1 |
| InChI | InChI=1S/C10H8F2N4O4/c11-4-1-2-6(16(18)19)8(12)7(4)9-14-10(20-15-9)5(13)3-17/h1-2,5,17H,3,13H2/t5-/m1/s1 |
| InChIKey | WJSVHMUHPACSDT-RXMQYKEDSA-N |
| XLogP | 0.92 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|