C9H5F2N5O2 — CID 79767338
4-(2,6-difluoro-3-nitrophenyl)-1,3,5-triazin-2-amine (PubChem CID 79767338) has the molecular formula C9H5F2N5O2 and a molecular weight of 253.17 g/mol. Its IUPAC name is 4-(2,6-difluoro-3-nitrophenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,6-difluoro-3-nitrophenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 79767338 |
| Molecular Formula | C9H5F2N5O2 |
| Molecular Weight | 253.17 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 4-(2,6-difluoro-3-nitrophenyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1ncnc(-c2c(F)ccc([N+](=O)[O-])c2F)n1 |
| InChI | InChI=1S/C9H5F2N5O2/c10-4-1-2-5(16(17)18)7(11)6(4)8-13-3-14-9(12)15-8/h1-3H,(H2,12,13,14,15) |
| InChIKey | HKBGSUMJYJKTAA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.17 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|