C11H7F2IN4O2 — CID 79757384
2-(2,6-difluoro-3-nitrophenyl)-5-iodo-6-methylpyrimidin-4-amine (PubChem CID 79757384) has the molecular formula C11H7F2IN4O2 and a molecular weight of 392.10 g/mol. Its IUPAC name is 2-(2,6-difluoro-3-nitrophenyl)-5-iodo-6-methylpyrimidin-4-amine.
| Compound Name | 2-(2,6-difluoro-3-nitrophenyl)-5-iodo-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 79757384 |
| Molecular Formula | C11H7F2IN4O2 |
| Molecular Weight | 392.10 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | 2-(2,6-difluoro-3-nitrophenyl)-5-iodo-6-methylpyrimidin-4-amine |
| SMILES | Cc1nc(-c2c(F)ccc([N+](=O)[O-])c2F)nc(N)c1I |
| InChI | InChI=1S/C11H7F2IN4O2/c1-4-9(14)10(15)17-11(16-4)7-5(12)2-3-6(8(7)13)18(19)20/h2-3H,1H3,(H2,15,16,17) |
| InChIKey | PROPJAFDDWIZLR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.10 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|