C11H8F2N4O3 — CID 79755256
N-cyclopropyl-3-(2,6-difluoro-3-nitrophenyl)-1,2,4-oxadiazol-5-amine (PubChem CID 79755256) has the molecular formula C11H8F2N4O3 and a molecular weight of 282.21 g/mol. Its IUPAC name is N-cyclopropyl-3-(2,6-difluoro-3-nitrophenyl)-1,2,4-oxadiazol-5-amine.
| Compound Name | N-cyclopropyl-3-(2,6-difluoro-3-nitrophenyl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 79755256 |
| Molecular Formula | C11H8F2N4O3 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | N-cyclopropyl-3-(2,6-difluoro-3-nitrophenyl)-1,2,4-oxadiazol-5-amine |
| SMILES | O=[N+]([O-])c1ccc(F)c(-c2noc(NC3CC3)n2)c1F |
| InChI | InChI=1S/C11H8F2N4O3/c12-6-3-4-7(17(18)19)9(13)8(6)10-15-11(20-16-10)14-5-1-2-5/h3-5H,1-2H2,(H,14,15,16) |
| InChIKey | VQVCYVAKZINXGS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|