C10H7F2N3O3 — CID 79768783
5-(2,6-difluoro-3-nitrophenyl)-4-methyl-1,2-oxazol-3-amine (PubChem CID 79768783) has the molecular formula C10H7F2N3O3 and a molecular weight of 255.18 g/mol. Its IUPAC name is 5-(2,6-difluoro-3-nitrophenyl)-4-methyl-1,2-oxazol-3-amine.
| Compound Name | 5-(2,6-difluoro-3-nitrophenyl)-4-methyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 79768783 |
| Molecular Formula | C10H7F2N3O3 |
| Molecular Weight | 255.18 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 5-(2,6-difluoro-3-nitrophenyl)-4-methyl-1,2-oxazol-3-amine |
| SMILES | Cc1c(N)noc1-c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C10H7F2N3O3/c1-4-9(18-14-10(4)13)7-5(11)2-3-6(8(7)12)15(16)17/h2-3H,1H3,(H2,13,14) |
| InChIKey | REZVUJVIYBXOHH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.18 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|