C12H12F2N4O3 — CID 79753728
1-[3-(2,6-difluoro-3-nitrophenyl)-1,2,4-oxadiazol-5-yl]-N-methylpropan-2-amine (PubChem CID 79753728) has the molecular formula C12H12F2N4O3 and a molecular weight of 298.25 g/mol. Its IUPAC name is 1-[3-(2,6-difluoro-3-nitrophenyl)-1,2,4-oxadiazol-5-yl]-N-methylpropan-2-amine.
| Compound Name | 1-[3-(2,6-difluoro-3-nitrophenyl)-1,2,4-oxadiazol-5-yl]-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 79753728 |
| Molecular Formula | C12H12F2N4O3 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 1-[3-(2,6-difluoro-3-nitrophenyl)-1,2,4-oxadiazol-5-yl]-N-methylpropan-2-amine |
| SMILES | CNC(C)Cc1nc(-c2c(F)ccc([N+](=O)[O-])c2F)no1 |
| InChI | InChI=1S/C12H12F2N4O3/c1-6(15-2)5-9-16-12(17-21-9)10-7(13)3-4-8(11(10)14)18(19)20/h3-4,6,15H,5H2,1-2H3 |
| InChIKey | NLLACGRWQZGOHL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|