C11H8F2N2O3S — CID 107511895
2-(2,6-difluoro-3-nitrophenyl)-4-(methoxymethyl)-1,3-thiazole (PubChem CID 107511895) has the molecular formula C11H8F2N2O3S and a molecular weight of 286.26 g/mol. Its IUPAC name is 2-(2,6-difluoro-3-nitrophenyl)-4-(methoxymethyl)-1,3-thiazole.
| Compound Name | 2-(2,6-difluoro-3-nitrophenyl)-4-(methoxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 107511895 |
| Molecular Formula | C11H8F2N2O3S |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 2-(2,6-difluoro-3-nitrophenyl)-4-(methoxymethyl)-1,3-thiazole |
| SMILES | COCc1csc(-c2c(F)ccc([N+](=O)[O-])c2F)n1 |
| InChI | InChI=1S/C11H8F2N2O3S/c1-18-4-6-5-19-11(14-6)9-7(12)2-3-8(10(9)13)15(16)17/h2-3,5H,4H2,1H3 |
| InChIKey | GGPLAHIZRIXSDP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|