C11H9F2N3O2S — CID 79757174
1-[2-(2,6-difluoro-3-nitrophenyl)-1,3-thiazol-5-yl]-N-methylmethanamine (PubChem CID 79757174) has the molecular formula C11H9F2N3O2S and a molecular weight of 285.27 g/mol. Its IUPAC name is 1-[2-(2,6-difluoro-3-nitrophenyl)-1,3-thiazol-5-yl]-N-methylmethanamine.
| Compound Name | 1-[2-(2,6-difluoro-3-nitrophenyl)-1,3-thiazol-5-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 79757174 |
| Molecular Formula | C11H9F2N3O2S |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 1-[2-(2,6-difluoro-3-nitrophenyl)-1,3-thiazol-5-yl]-N-methylmethanamine |
| SMILES | CNCc1cnc(-c2c(F)ccc([N+](=O)[O-])c2F)s1 |
| InChI | InChI=1S/C11H9F2N3O2S/c1-14-4-6-5-15-11(19-6)9-7(12)2-3-8(10(9)13)16(17)18/h2-3,5,14H,4H2,1H3 |
| InChIKey | HOLVMSYQUDVMQJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|