C13H13F2N3O3 — CID 79760085
3-[5-(2,6-difluoro-3-nitrophenyl)-1,3-oxazol-2-yl]-N-methylpropan-1-amine (PubChem CID 79760085) has the molecular formula C13H13F2N3O3 and a molecular weight of 297.26 g/mol. Its IUPAC name is 3-[5-(2,6-difluoro-3-nitrophenyl)-1,3-oxazol-2-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[5-(2,6-difluoro-3-nitrophenyl)-1,3-oxazol-2-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 79760085 |
| Molecular Formula | C13H13F2N3O3 |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3-[5-(2,6-difluoro-3-nitrophenyl)-1,3-oxazol-2-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCc1ncc(-c2c(F)ccc([N+](=O)[O-])c2F)o1 |
| InChI | InChI=1S/C13H13F2N3O3/c1-16-6-2-3-11-17-7-10(21-11)12-8(14)4-5-9(13(12)15)18(19)20/h4-5,7,16H,2-3,6H2,1H3 |
| InChIKey | SEIIKXIVWWKZPI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|