C12H11F2N3O3 — CID 65182991
2-[5-(4,5-difluoro-2-nitrophenyl)-1,3-oxazol-2-yl]-N-methylethanamine (PubChem CID 65182991) has the molecular formula C12H11F2N3O3 and a molecular weight of 283.23 g/mol. Its IUPAC name is 2-[5-(4,5-difluoro-2-nitrophenyl)-1,3-oxazol-2-yl]-N-methylethanamine.
| Compound Name | 2-[5-(4,5-difluoro-2-nitrophenyl)-1,3-oxazol-2-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 65182991 |
| Molecular Formula | C12H11F2N3O3 |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-[5-(4,5-difluoro-2-nitrophenyl)-1,3-oxazol-2-yl]-N-methylethanamine |
| SMILES | CNCCc1ncc(-c2cc(F)c(F)cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C12H11F2N3O3/c1-15-3-2-12-16-6-11(20-12)7-4-8(13)9(14)5-10(7)17(18)19/h4-6,15H,2-3H2,1H3 |
| InChIKey | BOJQFWNWPGBAFX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|